C12H12N2OS3 — CID 80744881
N-(2-amino-1-cyclopropyl-2-sulfanylideneethyl)thieno[3,2-b]thiophene-5-carboxamide (PubChem CID 80744881) has the molecular formula C12H12N2OS3 and a molecular weight of 296.44 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropyl-2-sulfanylideneethyl)thieno[3,2-b]thiophene-5-carboxamide.
| Compound Name | N-(2-amino-1-cyclopropyl-2-sulfanylideneethyl)thieno[3,2-b]thiophene-5-carboxamide |
|---|---|
| PubChem CID | 80744881 |
| Molecular Formula | C12H12N2OS3 |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | N-(2-amino-1-cyclopropyl-2-sulfanylideneethyl)thieno[3,2-b]thiophene-5-carboxamide |
| SMILES | NC(=S)C(NC(=O)c1cc2sccc2s1)C1CC1 |
| InChI | InChI=1S/C12H12N2OS3/c13-11(16)10(6-1-2-6)14-12(15)9-5-8-7(18-9)3-4-17-8/h3-6,10H,1-2H2,(H2,13,16)(H,14,15) |
| InChIKey | MGHKXODIAUTCJV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|