C13H13N3O2S2 — CID 107468410
N-(2-carbamothioyl-6-methoxyphenyl)-2-methyl-1,3-thiazole-4-carboxamide (PubChem CID 107468410) has the molecular formula C13H13N3O2S2 and a molecular weight of 307.40 g/mol. Its IUPAC name is N-(2-carbamothioyl-6-methoxyphenyl)-2-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2-carbamothioyl-6-methoxyphenyl)-2-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 107468410 |
| Molecular Formula | C13H13N3O2S2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | N-(2-carbamothioyl-6-methoxyphenyl)-2-methyl-1,3-thiazole-4-carboxamide |
| SMILES | COc1cccc(C(N)=S)c1NC(=O)c1csc(C)n1 |
| InChI | InChI=1S/C13H13N3O2S2/c1-7-15-9(6-20-7)13(17)16-11-8(12(14)19)4-3-5-10(11)18-2/h3-6H,1-2H3,(H2,14,19)(H,16,17) |
| InChIKey | QTVOZHNTTGQTAP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|