C18H21FN2O3S — CID 119227175
7-[[2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]acetyl]amino]heptanoic acid (PubChem CID 119227175) has the molecular formula C18H21FN2O3S and a molecular weight of 364.44 g/mol. Its IUPAC name is 7-[[2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]acetyl]amino]heptanoic acid.
| Compound Name | 7-[[2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]acetyl]amino]heptanoic acid |
|---|---|
| PubChem CID | 119227175 |
| Molecular Formula | C18H21FN2O3S |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 7-[[2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]acetyl]amino]heptanoic acid |
| SMILES | O=C(O)CCCCCCNC(=O)Cc1csc(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C18H21FN2O3S/c19-14-7-5-6-13(10-14)18-21-15(12-25-18)11-16(22)20-9-4-2-1-3-8-17(23)24/h5-7,10,12H,1-4,8-9,11H2,(H,20,22)(H,23,24) |
| InChIKey | JQGNVWKIYOBINF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|