C22H20ClN3O3S — CID 46680338
4-chloro-N-[4-[[4-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazol-2-yl]amino]-4-oxobutyl]benzamide (PubChem CID 46680338) has the molecular formula C22H20ClN3O3S and a molecular weight of 441.94 g/mol. Its IUPAC name is 4-chloro-N-[4-[[4-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazol-2-yl]amino]-4-oxobutyl]benzamide.
| Compound Name | 4-chloro-N-[4-[[4-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazol-2-yl]amino]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 46680338 |
| Molecular Formula | C22H20ClN3O3S |
| Molecular Weight | 441.94 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | 4-chloro-N-[4-[[4-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazol-2-yl]amino]-4-oxobutyl]benzamide |
| SMILES | O=C(CCCNC(=O)c1ccc(Cl)cc1)Nc1nc(-c2ccc3c(c2)CCO3)cs1 |
| InChI | InChI=1S/C22H20ClN3O3S/c23-17-6-3-14(4-7-17)21(28)24-10-1-2-20(27)26-22-25-18(13-30-22)15-5-8-19-16(12-15)9-11-29-19/h3-8,12-13H,1-2,9-11H2,(H,24,28)(H,25,26,27) |
| InChIKey | NLCAULBMLUKBRN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.94 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|