C18H12ClIN2O2S — CID 38937157
4-chloro-N-[4-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazol-2-yl]-2-iodobenzamide (PubChem CID 38937157) has the molecular formula C18H12ClIN2O2S and a molecular weight of 482.73 g/mol. Its IUPAC name is 4-chloro-N-[4-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazol-2-yl]-2-iodobenzamide.
| Compound Name | 4-chloro-N-[4-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazol-2-yl]-2-iodobenzamide |
|---|---|
| PubChem CID | 38937157 |
| Molecular Formula | C18H12ClIN2O2S |
| Molecular Weight | 482.73 g/mol |
| Exact Mass | 481.94 |
| IUPAC Name | 4-chloro-N-[4-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazol-2-yl]-2-iodobenzamide |
| SMILES | O=C(Nc1nc(-c2ccc3c(c2)CCO3)cs1)c1ccc(Cl)cc1I |
| InChI | InChI=1S/C18H12ClIN2O2S/c19-12-2-3-13(14(20)8-12)17(23)22-18-21-15(9-25-18)10-1-4-16-11(7-10)5-6-24-16/h1-4,7-9H,5-6H2,(H,21,22,23) |
| InChIKey | AAZBVYJZOHVSBJ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.73 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|