C19H23ClN4O3S — CID 30547785
4-chloro-N-[4-[[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]amino]-4-oxobutyl]benzamide (PubChem CID 30547785) has the molecular formula C19H23ClN4O3S and a molecular weight of 422.94 g/mol. Its IUPAC name is 4-chloro-N-[4-[[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]amino]-4-oxobutyl]benzamide.
| Compound Name | 4-chloro-N-[4-[[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]amino]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 30547785 |
| Molecular Formula | C19H23ClN4O3S |
| Molecular Weight | 422.94 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 4-chloro-N-[4-[[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]amino]-4-oxobutyl]benzamide |
| SMILES | O=C(CCCNC(=O)c1ccc(Cl)cc1)Nc1nc(CN2CCOCC2)cs1 |
| InChI | InChI=1S/C19H23ClN4O3S/c20-15-5-3-14(4-6-15)18(26)21-7-1-2-17(25)23-19-22-16(13-28-19)12-24-8-10-27-11-9-24/h3-6,13H,1-2,7-12H2,(H,21,26)(H,22,23,25) |
| InChIKey | BXZMPMKYVGEXHE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.94 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|