C19H31N5O3S — CID 29324976
4-(cyclohexylcarbamoylamino)-N-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]butanamide (PubChem CID 29324976) has the molecular formula C19H31N5O3S and a molecular weight of 409.56 g/mol. Its IUPAC name is 4-(cyclohexylcarbamoylamino)-N-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]butanamide.
| Compound Name | 4-(cyclohexylcarbamoylamino)-N-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 29324976 |
| Molecular Formula | C19H31N5O3S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | 4-(cyclohexylcarbamoylamino)-N-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]butanamide |
| SMILES | O=C(CCCNC(=O)NC1CCCCC1)Nc1nc(CN2CCOCC2)cs1 |
| InChI | InChI=1S/C19H31N5O3S/c25-17(7-4-8-20-18(26)21-15-5-2-1-3-6-15)23-19-22-16(14-28-19)13-24-9-11-27-12-10-24/h14-15H,1-13H2,(H2,20,21,26)(H,22,23,25) |
| InChIKey | NRWVKIPONOXRGL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|