C15H15ClN2O2S2 — CID 134030860
N-(4-acetyl-1,3-thiazol-2-yl)-4-(4-chlorophenyl)sulfanylbutanamide (PubChem CID 134030860) has the molecular formula C15H15ClN2O2S2 and a molecular weight of 354.88 g/mol. Its IUPAC name is N-(4-acetyl-1,3-thiazol-2-yl)-4-(4-chlorophenyl)sulfanylbutanamide.
| Compound Name | N-(4-acetyl-1,3-thiazol-2-yl)-4-(4-chlorophenyl)sulfanylbutanamide |
|---|---|
| PubChem CID | 134030860 |
| Molecular Formula | C15H15ClN2O2S2 |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | N-(4-acetyl-1,3-thiazol-2-yl)-4-(4-chlorophenyl)sulfanylbutanamide |
| SMILES | CC(=O)c1csc(NC(=O)CCCSc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C15H15ClN2O2S2/c1-10(19)13-9-22-15(17-13)18-14(20)3-2-8-21-12-6-4-11(16)5-7-12/h4-7,9H,2-3,8H2,1H3,(H,17,18,20) |
| InChIKey | CZVLYSQEMFXZLV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|