C21H18ClF3N2O2 — CID 163644683
(E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]prop-2-enamide (PubChem CID 163644683) has the molecular formula C21H18ClF3N2O2 and a molecular weight of 422.83 g/mol. Its IUPAC name is (E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 163644683 |
| Molecular Formula | C21H18ClF3N2O2 |
| Molecular Weight | 422.83 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | (E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]prop-2-enamide |
| SMILES | COc1ccc2[nH]cc(CCNC(=O)/C=C/c3cc(C(F)(F)F)ccc3Cl)c2c1 |
| InChI | InChI=1S/C21H18ClF3N2O2/c1-29-16-4-6-19-17(11-16)14(12-27-19)8-9-26-20(28)7-2-13-10-15(21(23,24)25)3-5-18(13)22/h2-7,10-12,27H,8-9H2,1H3,(H,26,28)/b7-2+ |
| InChIKey | IHGDNJKWSFZLEC-FARCUNLSSA-N |
| XLogP | 5.22 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.83 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|