C26H25BrFN3O2 — CID 122193134
(E)-3-[1-[(3-fluorophenyl)methyl]pyridin-1-ium-4-yl]-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]prop-2-enamide bromide (PubChem CID 122193134) has the molecular formula C26H25BrFN3O2 and a molecular weight of 510.41 g/mol. Its IUPAC name is (E)-3-[1-[(3-fluorophenyl)methyl]pyridin-1-ium-4-yl]-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]prop-2-enamide bromide.
| Compound Name | (E)-3-[1-[(3-fluorophenyl)methyl]pyridin-1-ium-4-yl]-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]prop-2-enamide bromide |
|---|---|
| PubChem CID | 122193134 |
| Molecular Formula | C26H25BrFN3O2 |
| Molecular Weight | 510.41 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | (E)-3-[1-[(3-fluorophenyl)methyl]pyridin-1-ium-4-yl]-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]prop-2-enamide bromide |
| SMILES | COc1ccc2[nH]cc(CCNC(=O)/C=C/c3cc[n+](Cc4cccc(F)c4)cc3)c2c1.[Br-] |
| InChI | InChI=1S/C26H24FN3O2.BrH/c1-32-23-6-7-25-24(16-23)21(17-29-25)9-12-28-26(31)8-5-19-10-13-30(14-11-19)18-20-3-2-4-22(27)15-20;/h2-8,10-11,13-17,29H,9,12,18H2,1H3;1H/b8-5+; |
| InChIKey | MNUYIALKACVQRS-HAAWTFQLSA-N |
| XLogP | 1.03 |
| TPSA | 58.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.41 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|