C19H19FN2OS — CID 4901690
3-(5-ethylthiophen-2-yl)-N-[2-(5-fluoro-1H-indol-3-yl)ethyl]prop-2-enamide (PubChem CID 4901690) has the molecular formula C19H19FN2OS and a molecular weight of 342.44 g/mol. Its IUPAC name is 3-(5-ethylthiophen-2-yl)-N-[2-(5-fluoro-1H-indol-3-yl)ethyl]prop-2-enamide.
| Compound Name | 3-(5-ethylthiophen-2-yl)-N-[2-(5-fluoro-1H-indol-3-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 4901690 |
| Molecular Formula | C19H19FN2OS |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 3-(5-ethylthiophen-2-yl)-N-[2-(5-fluoro-1H-indol-3-yl)ethyl]prop-2-enamide |
| SMILES | CCc1ccc(C=CC(=O)NCCc2c[nH]c3ccc(F)cc23)s1 |
| InChI | InChI=1S/C19H19FN2OS/c1-2-15-4-5-16(24-15)6-8-19(23)21-10-9-13-12-22-18-7-3-14(20)11-17(13)18/h3-8,11-12,22H,2,9-10H2,1H3,(H,21,23) |
| InChIKey | XRMBYURRVMEZAS-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|