C22H24N4O4 — CID 55868764
N-(2-amino-2-oxoethyl)-4-[[2-(3-phenylprop-2-enoylamino)propanoylamino]methyl]benzamide (PubChem CID 55868764) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-4-[[2-(3-phenylprop-2-enoylamino)propanoylamino]methyl]benzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-4-[[2-(3-phenylprop-2-enoylamino)propanoylamino]methyl]benzamide |
|---|---|
| PubChem CID | 55868764 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-4-[[2-(3-phenylprop-2-enoylamino)propanoylamino]methyl]benzamide |
| SMILES | CC(NC(=O)C=Cc1ccccc1)C(=O)NCc1ccc(C(=O)NCC(N)=O)cc1 |
| InChI | InChI=1S/C22H24N4O4/c1-15(26-20(28)12-9-16-5-3-2-4-6-16)21(29)24-13-17-7-10-18(11-8-17)22(30)25-14-19(23)27/h2-12,15H,13-14H2,1H3,(H2,23,27)(H,24,29)(H,25,30)(H,26,28) |
| InChIKey | DRNHBFFDXYNWPQ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|