C21H22N4O4 — CID 46494292
N-(2-amino-2-oxoethyl)-4-[[[(E)-3-[4-(methylcarbamoyl)phenyl]prop-2-enoyl]amino]methyl]benzamide (PubChem CID 46494292) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-4-[[[(E)-3-[4-(methylcarbamoyl)phenyl]prop-2-enoyl]amino]methyl]benzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-4-[[[(E)-3-[4-(methylcarbamoyl)phenyl]prop-2-enoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 46494292 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-4-[[[(E)-3-[4-(methylcarbamoyl)phenyl]prop-2-enoyl]amino]methyl]benzamide |
| SMILES | CNC(=O)c1ccc(/C=C/C(=O)NCc2ccc(C(=O)NCC(N)=O)cc2)cc1 |
| InChI | InChI=1S/C21H22N4O4/c1-23-20(28)16-7-2-14(3-8-16)6-11-19(27)24-12-15-4-9-17(10-5-15)21(29)25-13-18(22)26/h2-11H,12-13H2,1H3,(H2,22,26)(H,23,28)(H,24,27)(H,25,29)/b11-6+ |
| InChIKey | UPGWLMDAMCHKNT-IZZDOVSWSA-N |
| XLogP | 0.59 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|