C18H19N3O3 — CID 51076627
4-[(E)-3-[(6-methoxy-3-pyridinyl)methylamino]-3-oxoprop-1-enyl]-N-methylbenzamide (PubChem CID 51076627) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is 4-[(E)-3-[(6-methoxy-3-pyridinyl)methylamino]-3-oxoprop-1-enyl]-N-methylbenzamide.
| Compound Name | 4-[(E)-3-[(6-methoxy-3-pyridinyl)methylamino]-3-oxoprop-1-enyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 51076627 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 4-[(E)-3-[(6-methoxy-3-pyridinyl)methylamino]-3-oxoprop-1-enyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(/C=C/C(=O)NCc2ccc(OC)nc2)cc1 |
| InChI | InChI=1S/C18H19N3O3/c1-19-18(23)15-7-3-13(4-8-15)5-9-16(22)20-11-14-6-10-17(24-2)21-12-14/h3-10,12H,11H2,1-2H3,(H,19,23)(H,20,22)/b9-5+ |
| InChIKey | DVTGSJQDZPNYOT-WEVVVXLNSA-N |
| XLogP | 1.78 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|