C10H13N3O2 — CID 39969427
4-[(carbamoylamino)methyl]-N-methylbenzamide (PubChem CID 39969427) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 4-[(carbamoylamino)methyl]-N-methylbenzamide.
| Compound Name | 4-[(carbamoylamino)methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 39969427 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 4-[(carbamoylamino)methyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(CNC(N)=O)cc1 |
| InChI | InChI=1S/C10H13N3O2/c1-12-9(14)8-4-2-7(3-5-8)6-13-10(11)15/h2-5H,6H2,1H3,(H,12,14)(H3,11,13,15) |
| InChIKey | ZXBHPAZBPGGROC-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |