C14H22N2O2 — CID 145404666
ethane;N-methyl-4-[(propanoylamino)methyl]benzamide (PubChem CID 145404666) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is ethane;N-methyl-4-[(propanoylamino)methyl]benzamide.
| Compound Name | ethane;N-methyl-4-[(propanoylamino)methyl]benzamide |
|---|---|
| PubChem CID | 145404666 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | ethane;N-methyl-4-[(propanoylamino)methyl]benzamide |
| SMILES | CC.CCC(=O)NCc1ccc(C(=O)NC)cc1 |
| InChI | InChI=1S/C12H16N2O2.C2H6/c1-3-11(15)14-8-9-4-6-10(7-5-9)12(16)13-2;1-2/h4-7H,3,8H2,1-2H3,(H,13,16)(H,14,15);1-2H3 |
| InChIKey | WJJUQCFGYUTKER-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |