C17H19N3O2 — CID 29205734
4-[(carbamoylamino)methyl]-N-(3,5-dimethylphenyl)benzamide (PubChem CID 29205734) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 4-[(carbamoylamino)methyl]-N-(3,5-dimethylphenyl)benzamide.
| Compound Name | 4-[(carbamoylamino)methyl]-N-(3,5-dimethylphenyl)benzamide |
|---|---|
| PubChem CID | 29205734 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 4-[(carbamoylamino)methyl]-N-(3,5-dimethylphenyl)benzamide |
| SMILES | Cc1cc(C)cc(NC(=O)c2ccc(CNC(N)=O)cc2)c1 |
| InChI | InChI=1S/C17H19N3O2/c1-11-7-12(2)9-15(8-11)20-16(21)14-5-3-13(4-6-14)10-19-17(18)22/h3-9H,10H2,1-2H3,(H,20,21)(H3,18,19,22) |
| InChIKey | KNPQFFJWXBDHRB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |