C21H27N3O4 — CID 29216719
4-[(carbamoylamino)methyl]-N-(3,4-dipropoxyphenyl)benzamide (PubChem CID 29216719) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is 4-[(carbamoylamino)methyl]-N-(3,4-dipropoxyphenyl)benzamide.
| Compound Name | 4-[(carbamoylamino)methyl]-N-(3,4-dipropoxyphenyl)benzamide |
|---|---|
| PubChem CID | 29216719 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 4-[(carbamoylamino)methyl]-N-(3,4-dipropoxyphenyl)benzamide |
| SMILES | CCCOc1ccc(NC(=O)c2ccc(CNC(N)=O)cc2)cc1OCCC |
| InChI | InChI=1S/C21H27N3O4/c1-3-11-27-18-10-9-17(13-19(18)28-12-4-2)24-20(25)16-7-5-15(6-8-16)14-23-21(22)26/h5-10,13H,3-4,11-12,14H2,1-2H3,(H,24,25)(H3,22,23,26) |
| InChIKey | ZVNLKJDGMASYKS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |