C20H26N4O2 — CID 46560402
4-[(carbamoylamino)methyl]-N-[4-[ethyl(propan-2-yl)amino]phenyl]benzamide (PubChem CID 46560402) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 4-[(carbamoylamino)methyl]-N-[4-[ethyl(propan-2-yl)amino]phenyl]benzamide.
| Compound Name | 4-[(carbamoylamino)methyl]-N-[4-[ethyl(propan-2-yl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 46560402 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 4-[(carbamoylamino)methyl]-N-[4-[ethyl(propan-2-yl)amino]phenyl]benzamide |
| SMILES | CCN(c1ccc(NC(=O)c2ccc(CNC(N)=O)cc2)cc1)C(C)C |
| InChI | InChI=1S/C20H26N4O2/c1-4-24(14(2)3)18-11-9-17(10-12-18)23-19(25)16-7-5-15(6-8-16)13-22-20(21)26/h5-12,14H,4,13H2,1-3H3,(H,23,25)(H3,21,22,26) |
| InChIKey | PBJOWIOIVCVMKM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |