C17H16ClFN2O2 — CID 112998255
N-[2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl]-2-fluorobenzamide (PubChem CID 112998255) has the molecular formula C17H16ClFN2O2 and a molecular weight of 334.78 g/mol. Its IUPAC name is N-[2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl]-2-fluorobenzamide.
| Compound Name | N-[2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 112998255 |
| Molecular Formula | C17H16ClFN2O2 |
| Molecular Weight | 334.78 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | N-[2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl]-2-fluorobenzamide |
| SMILES | Cc1cc(C)c(NC(=O)CNC(=O)c2ccccc2F)c(Cl)c1 |
| InChI | InChI=1S/C17H16ClFN2O2/c1-10-7-11(2)16(13(18)8-10)21-15(22)9-20-17(23)12-5-3-4-6-14(12)19/h3-8H,9H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | CCNXPYRIHZPKGX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.78 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |