C18H19IN2O2 — CID 26713928
2-iodo-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]benzamide (PubChem CID 26713928) has the molecular formula C18H19IN2O2 and a molecular weight of 422.27 g/mol. Its IUPAC name is 2-iodo-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]benzamide.
| Compound Name | 2-iodo-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 26713928 |
| Molecular Formula | C18H19IN2O2 |
| Molecular Weight | 422.27 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | 2-iodo-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]benzamide |
| SMILES | Cc1cc(C)c(NC(=O)CNC(=O)c2ccccc2I)c(C)c1 |
| InChI | InChI=1S/C18H19IN2O2/c1-11-8-12(2)17(13(3)9-11)21-16(22)10-20-18(23)14-6-4-5-7-15(14)19/h4-9H,10H2,1-3H3,(H,20,23)(H,21,22) |
| InChIKey | LVLBCGXGWOXZPH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.27 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|