C21H18IN3O2 — CID 29265811
N-[2-(4-anilinoanilino)-2-oxoethyl]-2-iodobenzamide (PubChem CID 29265811) has the molecular formula C21H18IN3O2 and a molecular weight of 471.30 g/mol. Its IUPAC name is N-[2-(4-anilinoanilino)-2-oxoethyl]-2-iodobenzamide.
| Compound Name | N-[2-(4-anilinoanilino)-2-oxoethyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 29265811 |
| Molecular Formula | C21H18IN3O2 |
| Molecular Weight | 471.30 g/mol |
| Exact Mass | 471.04 |
| IUPAC Name | N-[2-(4-anilinoanilino)-2-oxoethyl]-2-iodobenzamide |
| SMILES | O=C(CNC(=O)c1ccccc1I)Nc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C21H18IN3O2/c22-19-9-5-4-8-18(19)21(27)23-14-20(26)25-17-12-10-16(11-13-17)24-15-6-2-1-3-7-15/h1-13,24H,14H2,(H,23,27)(H,25,26) |
| InChIKey | ZEWGYFHIYPYJSR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.30 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|