C17H17IN2O2 — CID 29263740
2-iodo-N-[2-oxo-2-(2-phenylethylamino)ethyl]benzamide (PubChem CID 29263740) has the molecular formula C17H17IN2O2 and a molecular weight of 408.24 g/mol. Its IUPAC name is 2-iodo-N-[2-oxo-2-(2-phenylethylamino)ethyl]benzamide.
| Compound Name | 2-iodo-N-[2-oxo-2-(2-phenylethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 29263740 |
| Molecular Formula | C17H17IN2O2 |
| Molecular Weight | 408.24 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | 2-iodo-N-[2-oxo-2-(2-phenylethylamino)ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1I)NCCc1ccccc1 |
| InChI | InChI=1S/C17H17IN2O2/c18-15-9-5-4-8-14(15)17(22)20-12-16(21)19-11-10-13-6-2-1-3-7-13/h1-9H,10-12H2,(H,19,21)(H,20,22) |
| InChIKey | GDXPUIAXLKUMOV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.24 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|