C16H21IN2O4 — CID 31840801
methyl 6-[[2-[(2-iodobenzoyl)amino]acetyl]amino]hexanoate (PubChem CID 31840801) has the molecular formula C16H21IN2O4 and a molecular weight of 432.26 g/mol. Its IUPAC name is methyl 6-[[2-[(2-iodobenzoyl)amino]acetyl]amino]hexanoate.
| Compound Name | methyl 6-[[2-[(2-iodobenzoyl)amino]acetyl]amino]hexanoate |
|---|---|
| PubChem CID | 31840801 |
| Molecular Formula | C16H21IN2O4 |
| Molecular Weight | 432.26 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | methyl 6-[[2-[(2-iodobenzoyl)amino]acetyl]amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)CNC(=O)c1ccccc1I |
| InChI | InChI=1S/C16H21IN2O4/c1-23-15(21)9-3-2-6-10-18-14(20)11-19-16(22)12-7-4-5-8-13(12)17/h4-5,7-8H,2-3,6,9-11H2,1H3,(H,18,20)(H,19,22) |
| InChIKey | CDXCRVHCPHZPHI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.26 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|