C19H22IN3O2 — CID 25472463
2-iodo-N-[2-[3-(N-methylanilino)propylamino]-2-oxoethyl]benzamide (PubChem CID 25472463) has the molecular formula C19H22IN3O2 and a molecular weight of 451.31 g/mol. Its IUPAC name is 2-iodo-N-[2-[3-(N-methylanilino)propylamino]-2-oxoethyl]benzamide.
| Compound Name | 2-iodo-N-[2-[3-(N-methylanilino)propylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 25472463 |
| Molecular Formula | C19H22IN3O2 |
| Molecular Weight | 451.31 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | 2-iodo-N-[2-[3-(N-methylanilino)propylamino]-2-oxoethyl]benzamide |
| SMILES | CN(CCCNC(=O)CNC(=O)c1ccccc1I)c1ccccc1 |
| InChI | InChI=1S/C19H22IN3O2/c1-23(15-8-3-2-4-9-15)13-7-12-21-18(24)14-22-19(25)16-10-5-6-11-17(16)20/h2-6,8-11H,7,12-14H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | OESAPLIPIVBPRC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|