C17H18IN3O4S — CID 2687936
2-iodo-N-[2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl]benzamide (PubChem CID 2687936) has the molecular formula C17H18IN3O4S and a molecular weight of 487.32 g/mol. Its IUPAC name is 2-iodo-N-[2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl]benzamide.
| Compound Name | 2-iodo-N-[2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 2687936 |
| Molecular Formula | C17H18IN3O4S |
| Molecular Weight | 487.32 g/mol |
| Exact Mass | 487.01 |
| IUPAC Name | 2-iodo-N-[2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl]benzamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)CNC(=O)c2ccccc2I)cc1 |
| InChI | InChI=1S/C17H18IN3O4S/c18-15-4-2-1-3-14(15)17(23)21-11-16(22)20-10-9-12-5-7-13(8-6-12)26(19,24)25/h1-8H,9-11H2,(H,20,22)(H,21,23)(H2,19,24,25) |
| InChIKey | SDUBAYNBADEDFN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|