C20H21IN2O4 — CID 35143035
butyl 4-[[2-[(2-iodobenzoyl)amino]acetyl]amino]benzoate (PubChem CID 35143035) has the molecular formula C20H21IN2O4 and a molecular weight of 480.30 g/mol. Its IUPAC name is butyl 4-[[2-[(2-iodobenzoyl)amino]acetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[(2-iodobenzoyl)amino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 35143035 |
| Molecular Formula | C20H21IN2O4 |
| Molecular Weight | 480.30 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | butyl 4-[[2-[(2-iodobenzoyl)amino]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)CNC(=O)c2ccccc2I)cc1 |
| InChI | InChI=1S/C20H21IN2O4/c1-2-3-12-27-20(26)14-8-10-15(11-9-14)23-18(24)13-22-19(25)16-6-4-5-7-17(16)21/h4-11H,2-3,12-13H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | PEGIUXNVULDZLU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.30 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|