C18H19IN4O2 — CID 30267909
2-iodo-N-[2-oxo-2-[(6-pyrrolidin-1-yl-3-pyridinyl)amino]ethyl]benzamide (PubChem CID 30267909) has the molecular formula C18H19IN4O2 and a molecular weight of 450.28 g/mol. Its IUPAC name is 2-iodo-N-[2-oxo-2-[(6-pyrrolidin-1-yl-3-pyridinyl)amino]ethyl]benzamide.
| Compound Name | 2-iodo-N-[2-oxo-2-[(6-pyrrolidin-1-yl-3-pyridinyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 30267909 |
| Molecular Formula | C18H19IN4O2 |
| Molecular Weight | 450.28 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | 2-iodo-N-[2-oxo-2-[(6-pyrrolidin-1-yl-3-pyridinyl)amino]ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1I)Nc1ccc(N2CCCC2)nc1 |
| InChI | InChI=1S/C18H19IN4O2/c19-15-6-2-1-5-14(15)18(25)21-12-17(24)22-13-7-8-16(20-11-13)23-9-3-4-10-23/h1-2,5-8,11H,3-4,9-10,12H2,(H,21,25)(H,22,24) |
| InChIKey | GADVSQINEOBHRE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|