C23H28N2O3 — CID 55774179
(E)-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]-3-(4-propoxyphenyl)prop-2-enamide (PubChem CID 55774179) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is (E)-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]-3-(4-propoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]-3-(4-propoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 55774179 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | (E)-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]-3-(4-propoxyphenyl)prop-2-enamide |
| SMILES | CCCOc1ccc(/C=C/C(=O)NCC(=O)Nc2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C23H28N2O3/c1-5-12-28-20-9-6-19(7-10-20)8-11-21(26)24-15-22(27)25-23-17(3)13-16(2)14-18(23)4/h6-11,13-14H,5,12,15H2,1-4H3,(H,24,26)(H,25,27)/b11-8+ |
| InChIKey | YPOZANAYFUKPIL-DHZHZOJOSA-N |
| XLogP | 4.17 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|