C16H11FN2OS2 — CID 36654925
(E)-3-[5-(2-fluorophenyl)thiophen-2-yl]-N-(1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 36654925) has the molecular formula C16H11FN2OS2 and a molecular weight of 330.41 g/mol. Its IUPAC name is (E)-3-[5-(2-fluorophenyl)thiophen-2-yl]-N-(1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-[5-(2-fluorophenyl)thiophen-2-yl]-N-(1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 36654925 |
| Molecular Formula | C16H11FN2OS2 |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | (E)-3-[5-(2-fluorophenyl)thiophen-2-yl]-N-(1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2ccccc2F)s1)Nc1nccs1 |
| InChI | InChI=1S/C16H11FN2OS2/c17-13-4-2-1-3-12(13)14-7-5-11(22-14)6-8-15(20)19-16-18-9-10-21-16/h1-10H,(H,18,19,20)/b8-6+ |
| InChIKey | KPLKDQXGXJSUJZ-SOFGYWHQSA-N |
| XLogP | 4.66 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|