About bis(2-fluoro-3,5-dimethylphenyl)methanone
bis(2-fluoro-3,5-dimethylphenyl)methanone (PubChem CID 139698663) has the molecular formula C17H16F2O
and a molecular weight of 274.31 g/mol. Its IUPAC name is bis(2-fluoro-3,5-dimethylphenyl)methanone.
Molecular Properties
| Compound Name | bis(2-fluoro-3,5-dimethylphenyl)methanone |
| PubChem CID | 139698663 |
| Molecular Formula | C17H16F2O |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | bis(2-fluoro-3,5-dimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(F)c(C(=O)c2cc(C)cc(C)c2F)c1 |
| InChI | InChI=1S/C17H16F2O/c1-9-5-11(3)15(18)13(7-9)17(20)14-8-10(2)6-12(4)16(14)19/h5-8H,1-4H3 |
| InChIKey | QWHYDHOHPNEGHE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze bis(2-fluoro-3,5-dimethylphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-fluoro-3,5-dimethylphenyl)methanone?
The IUPAC name of bis(2-fluoro-3,5-dimethylphenyl)methanone (CID 139698663) is bis(2-fluoro-3,5-dimethylphenyl)methanone.
What is the SMILES notation for bis(2-fluoro-3,5-dimethylphenyl)methanone?
The canonical SMILES for bis(2-fluoro-3,5-dimethylphenyl)methanone is Cc1cc(C)c(F)c(C(=O)c2cc(C)cc(C)c2F)c1.
What is the InChIKey of bis(2-fluoro-3,5-dimethylphenyl)methanone?
The InChIKey is QWHYDHOHPNEGHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16F2O/c1-9-5-11(3)15(18)13(7-9)17(20)14-8-10(2)6-12(4)16(14)19/h5-8H,1-4H3.
What are the key properties of bis(2-fluoro-3,5-dimethylphenyl)methanone?
bis(2-fluoro-3,5-dimethylphenyl)methanone has a molecular weight of 274.31 g/mol, XLogP of 4.43, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-fluoro-3,5-dimethylphenyl)methanone is sourced from PubChem (CID 139698663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).