C15H12BrFO — CID 43337277
(2-bromo-4-fluorophenyl)-(2,5-dimethylphenyl)methanone (PubChem CID 43337277) has the molecular formula C15H12BrFO and a molecular weight of 307.16 g/mol. Its IUPAC name is (2-bromo-4-fluorophenyl)-(2,5-dimethylphenyl)methanone.
| Compound Name | (2-bromo-4-fluorophenyl)-(2,5-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 43337277 |
| Molecular Formula | C15H12BrFO |
| Molecular Weight | 307.16 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | (2-bromo-4-fluorophenyl)-(2,5-dimethylphenyl)methanone |
| SMILES | Cc1ccc(C)c(C(=O)c2ccc(F)cc2Br)c1 |
| InChI | InChI=1S/C15H12BrFO/c1-9-3-4-10(2)13(7-9)15(18)12-6-5-11(17)8-14(12)16/h3-8H,1-2H3 |
| InChIKey | DGUHLMYVDSKANA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.16 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |