C13H11BrOS — CID 115784127
(4-bromothiophen-3-yl)-(2,5-dimethylphenyl)methanone (PubChem CID 115784127) has the molecular formula C13H11BrOS and a molecular weight of 295.20 g/mol. Its IUPAC name is (4-bromothiophen-3-yl)-(2,5-dimethylphenyl)methanone.
| Compound Name | (4-bromothiophen-3-yl)-(2,5-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 115784127 |
| Molecular Formula | C13H11BrOS |
| Molecular Weight | 295.20 g/mol |
| Exact Mass | 293.97 |
| IUPAC Name | (4-bromothiophen-3-yl)-(2,5-dimethylphenyl)methanone |
| SMILES | Cc1ccc(C)c(C(=O)c2cscc2Br)c1 |
| InChI | InChI=1S/C13H11BrOS/c1-8-3-4-9(2)10(5-8)13(15)11-6-16-7-12(11)14/h3-7H,1-2H3 |
| InChIKey | WEWPKWJYQIIHNC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.20 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |