C15H15ClN6O4 — CID 169340537
ethyl N-[[5-chloro-2-[2-(dicyanomethylidene)hydrazinyl]-3-methoxy-6-methylbenzoyl]amino]carbamate (PubChem CID 169340537) has the molecular formula C15H15ClN6O4 and a molecular weight of 378.78 g/mol. Its IUPAC name is ethyl N-[[5-chloro-2-[2-(dicyanomethylidene)hydrazinyl]-3-methoxy-6-methylbenzoyl]amino]carbamate.
| Compound Name | ethyl N-[[5-chloro-2-[2-(dicyanomethylidene)hydrazinyl]-3-methoxy-6-methylbenzoyl]amino]carbamate |
|---|---|
| PubChem CID | 169340537 |
| Molecular Formula | C15H15ClN6O4 |
| Molecular Weight | 378.78 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | ethyl N-[[5-chloro-2-[2-(dicyanomethylidene)hydrazinyl]-3-methoxy-6-methylbenzoyl]amino]carbamate |
| SMILES | CCOC(=O)NNC(=O)c1c(C)c(Cl)cc(OC)c1NN=C(C#N)C#N |
| InChI | InChI=1S/C15H15ClN6O4/c1-4-26-15(24)22-21-14(23)12-8(2)10(16)5-11(25-3)13(12)20-19-9(6-17)7-18/h5,20H,4H2,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | DCNHPFRITNMROQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 148.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.78 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|