C15H18ClN5O4S — CID 169363347
ethyl N-[[5-chloro-2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-3-methoxy-6-methylbenzoyl]amino]carbamate (PubChem CID 169363347) has the molecular formula C15H18ClN5O4S and a molecular weight of 399.86 g/mol. Its IUPAC name is ethyl N-[[5-chloro-2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-3-methoxy-6-methylbenzoyl]amino]carbamate.
| Compound Name | ethyl N-[[5-chloro-2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-3-methoxy-6-methylbenzoyl]amino]carbamate |
|---|---|
| PubChem CID | 169363347 |
| Molecular Formula | C15H18ClN5O4S |
| Molecular Weight | 399.86 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | ethyl N-[[5-chloro-2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-3-methoxy-6-methylbenzoyl]amino]carbamate |
| SMILES | CCOC(=O)NNC(=O)c1c(C)c(Cl)cc(OC)c1/N=C(/NC#N)SC |
| InChI | InChI=1S/C15H18ClN5O4S/c1-5-25-15(23)21-20-13(22)11-8(2)9(16)6-10(24-3)12(11)19-14(26-4)18-7-17/h6H,5H2,1-4H3,(H,18,19)(H,20,22)(H,21,23) |
| InChIKey | FOSBJCJJVGVYDV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.86 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|