C11H10ClN3O2S — CID 169364522
5-chloro-2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-3-methylbenzoic acid (PubChem CID 169364522) has the molecular formula C11H10ClN3O2S and a molecular weight of 283.74 g/mol. Its IUPAC name is 5-chloro-2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-3-methylbenzoic acid.
| Compound Name | 5-chloro-2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 169364522 |
| Molecular Formula | C11H10ClN3O2S |
| Molecular Weight | 283.74 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 5-chloro-2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-3-methylbenzoic acid |
| SMILES | CS/C(=N\c1c(C)cc(Cl)cc1C(=O)O)NC#N |
| InChI | InChI=1S/C11H10ClN3O2S/c1-6-3-7(12)4-8(10(16)17)9(6)15-11(18-2)14-5-13/h3-4H,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | GMWNPRXLRADGBL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 85.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.74 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|