C9H6Cl2IN3S — CID 169360270
methyl N-cyano-N'-(2,4-dichloro-6-iodophenyl)carbamimidothioate (PubChem CID 169360270) has the molecular formula C9H6Cl2IN3S and a molecular weight of 386.05 g/mol. Its IUPAC name is methyl N-cyano-N'-(2,4-dichloro-6-iodophenyl)carbamimidothioate.
| Compound Name | methyl N-cyano-N'-(2,4-dichloro-6-iodophenyl)carbamimidothioate |
|---|---|
| PubChem CID | 169360270 |
| Molecular Formula | C9H6Cl2IN3S |
| Molecular Weight | 386.05 g/mol |
| Exact Mass | 384.87 |
| IUPAC Name | methyl N-cyano-N'-(2,4-dichloro-6-iodophenyl)carbamimidothioate |
| SMILES | CS/C(=N\c1c(Cl)cc(Cl)cc1I)NC#N |
| InChI | InChI=1S/C9H6Cl2IN3S/c1-16-9(14-4-13)15-8-6(11)2-5(10)3-7(8)12/h2-3H,1H3,(H,14,15) |
| InChIKey | QUVLYCSHFPSBML-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.05 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|