C9H5Cl2N5OS — CID 169362479
methyl N-cyano-N'-(5,7-dichloro-2,1,3-benzoxadiazol-4-yl)carbamimidothioate (PubChem CID 169362479) has the molecular formula C9H5Cl2N5OS and a molecular weight of 302.15 g/mol. Its IUPAC name is methyl N-cyano-N'-(5,7-dichloro-2,1,3-benzoxadiazol-4-yl)carbamimidothioate.
| Compound Name | methyl N-cyano-N'-(5,7-dichloro-2,1,3-benzoxadiazol-4-yl)carbamimidothioate |
|---|---|
| PubChem CID | 169362479 |
| Molecular Formula | C9H5Cl2N5OS |
| Molecular Weight | 302.15 g/mol |
| Exact Mass | 300.96 |
| IUPAC Name | methyl N-cyano-N'-(5,7-dichloro-2,1,3-benzoxadiazol-4-yl)carbamimidothioate |
| SMILES | CS/C(=N\c1c(Cl)cc(Cl)c2nonc12)NC#N |
| InChI | InChI=1S/C9H5Cl2N5OS/c1-18-9(13-3-12)14-6-4(10)2-5(11)7-8(6)16-17-15-7/h2H,1H3,(H,13,14) |
| InChIKey | NVNJKLQKEYGERF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 87.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.15 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diazox_B(3)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|