C9H5BrClF2N3S — CID 169360901
methyl N'-(6-bromo-2-chloro-3,4-difluorophenyl)-N-cyanocarbamimidothioate (PubChem CID 169360901) has the molecular formula C9H5BrClF2N3S and a molecular weight of 340.58 g/mol. Its IUPAC name is methyl N'-(6-bromo-2-chloro-3,4-difluorophenyl)-N-cyanocarbamimidothioate.
| Compound Name | methyl N'-(6-bromo-2-chloro-3,4-difluorophenyl)-N-cyanocarbamimidothioate |
|---|---|
| PubChem CID | 169360901 |
| Molecular Formula | C9H5BrClF2N3S |
| Molecular Weight | 340.58 g/mol |
| Exact Mass | 338.90 |
| IUPAC Name | methyl N'-(6-bromo-2-chloro-3,4-difluorophenyl)-N-cyanocarbamimidothioate |
| SMILES | CS/C(=N\c1c(Br)cc(F)c(F)c1Cl)NC#N |
| InChI | InChI=1S/C9H5BrClF2N3S/c1-17-9(15-3-14)16-8-4(10)2-5(12)7(13)6(8)11/h2H,1H3,(H,15,16) |
| InChIKey | OSJHKVFKSXFBPR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.58 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|