C9H7F2N3OS — CID 169363862
methyl N-cyano-N'-(2,6-difluoro-4-hydroxyphenyl)carbamimidothioate (PubChem CID 169363862) has the molecular formula C9H7F2N3OS and a molecular weight of 243.24 g/mol. Its IUPAC name is methyl N-cyano-N'-(2,6-difluoro-4-hydroxyphenyl)carbamimidothioate.
| Compound Name | methyl N-cyano-N'-(2,6-difluoro-4-hydroxyphenyl)carbamimidothioate |
|---|---|
| PubChem CID | 169363862 |
| Molecular Formula | C9H7F2N3OS |
| Molecular Weight | 243.24 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | methyl N-cyano-N'-(2,6-difluoro-4-hydroxyphenyl)carbamimidothioate |
| SMILES | CS/C(=N\c1c(F)cc(O)cc1F)NC#N |
| InChI | InChI=1S/C9H7F2N3OS/c1-16-9(13-4-12)14-8-6(10)2-5(15)3-7(8)11/h2-3,15H,1H3,(H,13,14) |
| InChIKey | DTJNHQCFLSJRML-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 68.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|