C11H9BrF3N3OS — CID 169363723
methyl N'-[2-bromo-6-methyl-4-(trifluoromethoxy)phenyl]-N-cyanocarbamimidothioate (PubChem CID 169363723) has the molecular formula C11H9BrF3N3OS and a molecular weight of 368.18 g/mol. Its IUPAC name is methyl N'-[2-bromo-6-methyl-4-(trifluoromethoxy)phenyl]-N-cyanocarbamimidothioate.
| Compound Name | methyl N'-[2-bromo-6-methyl-4-(trifluoromethoxy)phenyl]-N-cyanocarbamimidothioate |
|---|---|
| PubChem CID | 169363723 |
| Molecular Formula | C11H9BrF3N3OS |
| Molecular Weight | 368.18 g/mol |
| Exact Mass | 366.96 |
| IUPAC Name | methyl N'-[2-bromo-6-methyl-4-(trifluoromethoxy)phenyl]-N-cyanocarbamimidothioate |
| SMILES | CS/C(=N\c1c(C)cc(OC(F)(F)F)cc1Br)NC#N |
| InChI | InChI=1S/C11H9BrF3N3OS/c1-6-3-7(19-11(13,14)15)4-8(12)9(6)18-10(20-2)17-5-16/h3-4H,1-2H3,(H,17,18) |
| InChIKey | NPAKRDZQUAOFBI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 57.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.18 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|