C11H9Cl2F4NO2 — CID 103857427
2,4-dichloro-5-fluoro-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 103857427) has the molecular formula C11H9Cl2F4NO2 and a molecular weight of 334.10 g/mol. Its IUPAC name is 2,4-dichloro-5-fluoro-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2,4-dichloro-5-fluoro-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 103857427 |
| Molecular Formula | C11H9Cl2F4NO2 |
| Molecular Weight | 334.10 g/mol |
| Exact Mass | 332.99 |
| IUPAC Name | 2,4-dichloro-5-fluoro-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(c1cc(F)c(Cl)cc1Cl)N(CCO)CC(F)(F)F |
| InChI | InChI=1S/C11H9Cl2F4NO2/c12-7-4-8(13)9(14)3-6(7)10(20)18(1-2-19)5-11(15,16)17/h3-4,19H,1-2,5H2 |
| InChIKey | USPBHPGWTSSJFW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.10 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|