C12H13BrN2O — CID 103751770
2-bromo-N,N-bis(prop-2-enyl)pyridine-3-carboxamide (PubChem CID 103751770) has the molecular formula C12H13BrN2O and a molecular weight of 281.15 g/mol. Its IUPAC name is 2-bromo-N,N-bis(prop-2-enyl)pyridine-3-carboxamide.
| Compound Name | 2-bromo-N,N-bis(prop-2-enyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 103751770 |
| Molecular Formula | C12H13BrN2O |
| Molecular Weight | 281.15 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | 2-bromo-N,N-bis(prop-2-enyl)pyridine-3-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)c1cccnc1Br |
| InChI | InChI=1S/C12H13BrN2O/c1-3-8-15(9-4-2)12(16)10-6-5-7-14-11(10)13/h3-7H,1-2,8-9H2 |
| InChIKey | IDOAIZXJNNTMBD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.15 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|