C12H14F2N2O3 — CID 114036658
2-[(2,3-difluoropyridine-4-carbonyl)-ethylamino]-2-methylpropanoic acid (PubChem CID 114036658) has the molecular formula C12H14F2N2O3 and a molecular weight of 272.25 g/mol. Its IUPAC name is 2-[(2,3-difluoropyridine-4-carbonyl)-ethylamino]-2-methylpropanoic acid.
| Compound Name | 2-[(2,3-difluoropyridine-4-carbonyl)-ethylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 114036658 |
| Molecular Formula | C12H14F2N2O3 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2-[(2,3-difluoropyridine-4-carbonyl)-ethylamino]-2-methylpropanoic acid |
| SMILES | CCN(C(=O)c1ccnc(F)c1F)C(C)(C)C(=O)O |
| InChI | InChI=1S/C12H14F2N2O3/c1-4-16(12(2,3)11(18)19)10(17)7-5-6-15-9(14)8(7)13/h5-6H,4H2,1-3H3,(H,18,19) |
| InChIKey | WKKCKEUQXDXGBV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|