C13H13F4NO3 — CID 62818415
2-[ethyl-(2,3,4,5-tetrafluorobenzoyl)amino]-2-methylpropanoic acid (PubChem CID 62818415) has the molecular formula C13H13F4NO3 and a molecular weight of 307.24 g/mol. Its IUPAC name is 2-[ethyl-(2,3,4,5-tetrafluorobenzoyl)amino]-2-methylpropanoic acid.
| Compound Name | 2-[ethyl-(2,3,4,5-tetrafluorobenzoyl)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 62818415 |
| Molecular Formula | C13H13F4NO3 |
| Molecular Weight | 307.24 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 2-[ethyl-(2,3,4,5-tetrafluorobenzoyl)amino]-2-methylpropanoic acid |
| SMILES | CCN(C(=O)c1cc(F)c(F)c(F)c1F)C(C)(C)C(=O)O |
| InChI | InChI=1S/C13H13F4NO3/c1-4-18(13(2,3)12(20)21)11(19)6-5-7(14)9(16)10(17)8(6)15/h5H,4H2,1-3H3,(H,20,21) |
| InChIKey | LMMWLIHNYDPDGF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|