C13H14Cl2INO3 — CID 62818591
2-[(3,5-dichloro-2-iodobenzoyl)-ethylamino]-2-methylpropanoic acid (PubChem CID 62818591) has the molecular formula C13H14Cl2INO3 and a molecular weight of 430.07 g/mol. Its IUPAC name is 2-[(3,5-dichloro-2-iodobenzoyl)-ethylamino]-2-methylpropanoic acid.
| Compound Name | 2-[(3,5-dichloro-2-iodobenzoyl)-ethylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 62818591 |
| Molecular Formula | C13H14Cl2INO3 |
| Molecular Weight | 430.07 g/mol |
| Exact Mass | 428.94 |
| IUPAC Name | 2-[(3,5-dichloro-2-iodobenzoyl)-ethylamino]-2-methylpropanoic acid |
| SMILES | CCN(C(=O)c1cc(Cl)cc(Cl)c1I)C(C)(C)C(=O)O |
| InChI | InChI=1S/C13H14Cl2INO3/c1-4-17(13(2,3)12(19)20)11(18)8-5-7(14)6-9(15)10(8)16/h5-6H,4H2,1-3H3,(H,19,20) |
| InChIKey | RKCJUXNCZBGJGL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.07 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|