C11H10Cl2INO3 — CID 43407668
methyl 2-[(3,5-dichloro-2-iodobenzoyl)-methylamino]acetate (PubChem CID 43407668) has the molecular formula C11H10Cl2INO3 and a molecular weight of 402.02 g/mol. Its IUPAC name is methyl 2-[(3,5-dichloro-2-iodobenzoyl)-methylamino]acetate.
| Compound Name | methyl 2-[(3,5-dichloro-2-iodobenzoyl)-methylamino]acetate |
|---|---|
| PubChem CID | 43407668 |
| Molecular Formula | C11H10Cl2INO3 |
| Molecular Weight | 402.02 g/mol |
| Exact Mass | 400.91 |
| IUPAC Name | methyl 2-[(3,5-dichloro-2-iodobenzoyl)-methylamino]acetate |
| SMILES | COC(=O)CN(C)C(=O)c1cc(Cl)cc(Cl)c1I |
| InChI | InChI=1S/C11H10Cl2INO3/c1-15(5-9(16)18-2)11(17)7-3-6(12)4-8(13)10(7)14/h3-4H,5H2,1-2H3 |
| InChIKey | WJHFZVNHYVRVEW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.02 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|