C13H16INO4 — CID 46849284
(2-formyl-6-iodo-3-methoxyphenyl) N,N-diethylcarbamate (PubChem CID 46849284) has the molecular formula C13H16INO4 and a molecular weight of 377.18 g/mol. Its IUPAC name is (2-formyl-6-iodo-3-methoxyphenyl) N,N-diethylcarbamate.
| Compound Name | (2-formyl-6-iodo-3-methoxyphenyl) N,N-diethylcarbamate |
|---|---|
| PubChem CID | 46849284 |
| Molecular Formula | C13H16INO4 |
| Molecular Weight | 377.18 g/mol |
| Exact Mass | 377.01 |
| IUPAC Name | (2-formyl-6-iodo-3-methoxyphenyl) N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)Oc1c(I)ccc(OC)c1C=O |
| InChI | InChI=1S/C13H16INO4/c1-4-15(5-2)13(17)19-12-9(8-16)11(18-3)7-6-10(12)14/h6-8H,4-5H2,1-3H3 |
| InChIKey | MQVGUMAITCVWEW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.18 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|