C17H21Cl2NO5 — CID 171486615
ethyl (E)-3-[2,3-dichloro-6-(diethylcarbamoyloxy)-5-methoxyphenyl]prop-2-enoate (PubChem CID 171486615) has the molecular formula C17H21Cl2NO5 and a molecular weight of 390.26 g/mol. Its IUPAC name is ethyl (E)-3-[2,3-dichloro-6-(diethylcarbamoyloxy)-5-methoxyphenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[2,3-dichloro-6-(diethylcarbamoyloxy)-5-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 171486615 |
| Molecular Formula | C17H21Cl2NO5 |
| Molecular Weight | 390.26 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | ethyl (E)-3-[2,3-dichloro-6-(diethylcarbamoyloxy)-5-methoxyphenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1c(Cl)c(Cl)cc(OC)c1OC(=O)N(CC)CC |
| InChI | InChI=1S/C17H21Cl2NO5/c1-5-20(6-2)17(22)25-16-11(8-9-14(21)24-7-3)15(19)12(18)10-13(16)23-4/h8-10H,5-7H2,1-4H3/b9-8+ |
| InChIKey | VHAHXGMIUWXJIW-CMDGGOBGSA-N |
| XLogP | 4.42 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.26 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|