C22H29NO3 — CID 44551915
[4-tert-butyl-2-(3-methoxyphenyl)phenyl] N,N-diethylcarbamate (PubChem CID 44551915) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is [4-tert-butyl-2-(3-methoxyphenyl)phenyl] N,N-diethylcarbamate.
| Compound Name | [4-tert-butyl-2-(3-methoxyphenyl)phenyl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 44551915 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | [4-tert-butyl-2-(3-methoxyphenyl)phenyl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)Oc1ccc(C(C)(C)C)cc1-c1cccc(OC)c1 |
| InChI | InChI=1S/C22H29NO3/c1-7-23(8-2)21(24)26-20-13-12-17(22(3,4)5)15-19(20)16-10-9-11-18(14-16)25-6/h9-15H,7-8H2,1-6H3 |
| InChIKey | QFRPKLNCCJMQBS-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |